ಬ್ರೌನ್ ಶುಗರ್ (ಅಮಲು ಪದಾರ್ಥ): ಪರಿಷ್ಕರಣೆಗಳ ನಡುವಿನ ವ್ಯತ್ಯಾಸ

Content deleted Content added
No edit summary
ವಿಸ್ತರಣೆ
೧ ನೇ ಸಾಲು:
[[ಚಿತ್ರ:Heroin_asian.jpg|thumb]]
{{drugbox
| Watchedfields = changed
| verifiedrevid = 443854562
| drug_name = Heroin
| INN = Diamorphine<ref name="Heroin's rINN"/>
| IUPAC_name = (5α,6α)-7,8-didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol diacetate
| image = Heroin - Heroine.svg
| image2 = Heroin-from-xtal-horizontal-3D-balls.png
 
<!--Clinical data-->
ಬ್ರೌನ್ ಶುಗರ್ ಎಂಬುದು ಒಂದು ಬಗೆಯ ಡ್ರಗ್. ಇದು [[ಸಕ್ಕರೆ]]ಯಲ್ಲ,ಮಾನಸಿಕವಾಗಿ ಭ್ರಮಾಲೋಕದಲ್ಲಿರುವಂತೆ ಮಾಡುವ ಮಾದಕ ವಸ್ತು. ಇದರ ದುರುಪಯೋಗವು ಅನೇಕ ಯುವಕ-ಯುವತಿಯರ ಉಜ್ವಲ ಭವಿಷ್ಯವನ್ನು ಹಾಳು ಮಾಡಿದೆ. ಆರೋಗ್ಯದ ಮೇಲೆ ದುಷ್ಪರಿಣಾಮ ಉಂಟುಮಾಡುವ ಇವುಗಳನ್ನು ಮನೋರೋಗಿಗಳಿಗೆ ನಿಗದಿತ ಅನುಪಾತದಲ್ಲಿ ನೀಡಿದಾಗ ಔಷಧಿಯಾಗಿ ಬಳಕೆಯಾಗುವುದಾದರೂ ಬ್ರೌನ್ ಶುಗರ್ ನ ಅನಿರ್ಬಂದಿತ ಸೇವನೆಯು ಚಟವಾಗಿ ಪರಿಣಮಿಸಿ ಯುವಜನತೆ ಬದುಕನ್ನೇ ದುರ್ಭರವನ್ನಾಗಿಸಿಕೊಳ್ಳುವ ಅಪಾಯವಿದೆ ಎಚ್ಚರ. ಯಾವುದೇ ರೂಪದಲ್ಲಿ ಸೇವಿಸಿ ನೋಡುವ ಪ್ರಯತ್ನ ಮಾಡಲೇಬಾರದು.
| pronounce = Heroin: {{IPAc-en|ˈ|h|ɛ|r|o:|ɪ|n}}
{{ಚುಟುಕು|ಮತ್ತು ಇದು ಒಂದು ಸಾಮಾಜಿಕ ಕಳಕಳಿಯ ಲೇಖನವಾಗಿದೆ}}
| Drugs.com = {{drugs.com|parent|heroin}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU_comment =
| pregnancy_US = <!-- A / B / C / D / X / N -->
| pregnancy_US_comment =
| pregnancy_category =
| legal_AU = S9
| legal_CA = Schedule I
| legal_DE = Anlage I
| legal_NZ = Class A
| legal_UK = Class A
| legal_US = Schedule I
| legal_UN = Narcotic Schedules I and IV
| dependency_liability = Physical: Very high<br />Psychological: Very high
| addiction_liability = Highly<ref name=Drugs2014/>
| routes_of_administration = Intravenous, inhalation, transmucosal, by mouth, intranasal, rectal, intramuscular, subcutaneous, intrathecal
| class = [[opiate]]
 
<!--Pharmacokinetic data-->
| bioavailability = <35% (by mouth), 44–61% (inhaled)<ref name="pmid16433897">{{cite journal |vauthors=Rook EJ, van Ree JM, van den Brink W, Hillebrand MJ, Huitema AD, Hendriks VM, Beijnen JH | title = Pharmacokinetics and pharmacodynamics of high doses of pharmaceutically prepared heroin, by intravenous or by inhalation route in opioid-dependent patients | journal = Basic Clin. Pharmacol. Toxicol. | volume = 98 | issue = 1 | pages = 86–96 | year = 2006 | pmid = 16433897 | doi = 10.1111/j.1742-7843.2006.pto_233.x }}</ref>
| protein_bound = 0% ([[morphine]] metabolite 35%)
| metabolism = [[liver]]
| onset = Within minutes<ref>{{cite book|last1=Riviello|first1=Ralph J.|title=Manual of forensic emergency medicine : a guide for clinicians|date=2010|publisher=Jones and Bartlett Publishers|location=Sudbury, Mass.|isbn=978-0-7637-4462-5|page=41|url=https://books.google.ca/books?id=keng9ELAE2IC&pg=PA41}}</ref>
| elimination_half-life = 2–3 minutes<ref name = EMC>{{cite web|title=Diamorphine Hydrochloride Injection 30 mg – Summary of Product Characteristics|work=electronic Medicines Compendium|publisher=ViroPharma Limited|date=24 September 2013|accessdate=30 March 2014|url=http://www.medicines.org.uk/emc/medicine/28258/SPC/Diamorphine+Hydrochloride+Injection+30+mg/}}</ref>
| duration_of_action= 4 to 5 hours<ref>{{cite book|last1=Field|first1=John|title=The Textbook of Emergency Cardiovascular Care and CPR|date=2012|publisher=Lippincott Williams & Wilkins|isbn=978-1-4698-0162-9|page=447|url=https://books.google.ca/books?id=o3m4oNRB4D4C&pg=PA447}}</ref>
| excretion = 90% [[kidney]] as [[glucuronide]]s, rest [[biliary]]
 
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 561-27-3
| ATC_prefix = N07
| ATC_suffix = BC06
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 27808
| PubChem = 5462328
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01452
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4575379
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8H672SHT8E
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 459324
 
<!--Chemical data-->
| C=21 | H=23 | N=1 | O=5
| molecular_weight = 369.41&nbsp;g/mol
| smiles = CC(OC1=C(O[C@@H]2[C@]34CCN(C)[C@@H]([C@@H]4C=C[C@@H]2OC(C)=O)C5)C3=C5C=C1)=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H23NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4-7,14-15,17,20H,8-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GVGLGOZIDCSQPN-PVHGPHFFSA-N
| synonyms = Diamorphine, Diacetylmorphine, Acetomorphine, (Dual) Acetylated morphine, Morphine diacetate
|alt=|caption=|type=|MedlinePlus=|legal_status=|licence_EU=|licence_US=}}
 
'''ಬ್ರೌನ್ ಶುಗರ್''' ಎಂಬುದು ಹೆರಾಯಿನ್ ಇನ್ನೊಂದು ಹೆಸರು.ಇದು ಒಂದು ಬಗೆಯ ಡ್ರಗ್ಅಮಲುಪದಾರ್ಥ. ಇದು [[ಸಕ್ಕರೆ]]ಯಲ್ಲ,ಮಾನಸಿಕವಾಗಿ ಭ್ರಮಾಲೋಕದಲ್ಲಿರುವಂತೆ ಮಾಡುವ ಮಾದಕ ವಸ್ತು. ಇದರ ದುರುಪಯೋಗವು ಅನೇಕ ಯುವಕ-ಯುವತಿಯರ ಉಜ್ವಲ ಭವಿಷ್ಯವನ್ನು ಹಾಳು ಮಾಡಿದೆ. ಆರೋಗ್ಯದ ಮೇಲೆ ದುಷ್ಪರಿಣಾಮ ಉಂಟುಮಾಡುವ ಇವುಗಳನ್ನು ಮನೋರೋಗಿಗಳಿಗೆ ನಿಗದಿತ ಅನುಪಾತದಲ್ಲಿ ನೀಡಿದಾಗ ಔಷಧಿಯಾಗಿ ಬಳಕೆಯಾಗುವುದಾದರೂ ಬ್ರೌನ್ ಶುಗರ್ ನ ಅನಿರ್ಬಂದಿತ ಸೇವನೆಯು ಚಟವಾಗಿ ಪರಿಣಮಿಸಿ ಯುವಜನತೆ ಬದುಕನ್ನೇ ದುರ್ಭರವನ್ನಾಗಿಸಿಕೊಳ್ಳುವ ಅಪಾಯವಿದೆ ಎಚ್ಚರ. ಯಾವುದೇ ರೂಪದಲ್ಲಿ ಸೇವಿಸಿ ನೋಡುವ ಪ್ರಯತ್ನ ಮಾಡಲೇಬಾರದು.
==ಉಲ್ಲೇಖಗಳು==
{{reflist}}
{{ಚುಟುಕು|}}